C14H8Cl2N2O5 — CID 126380677
2-[(3,5-dichlorophenyl)carbamoyl]-4-nitrobenzoic acid (PubChem CID 126380677) has the molecular formula C14H8Cl2N2O5 and a molecular weight of 355.13 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)carbamoyl]-4-nitrobenzoic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)carbamoyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 126380677 |
| Molecular Formula | C14H8Cl2N2O5 |
| Molecular Weight | 355.13 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)carbamoyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O5/c15-7-3-8(16)5-9(4-7)17-13(19)12-6-10(18(22)23)1-2-11(12)14(20)21/h1-6H,(H,17,19)(H,20,21) |
| InChIKey | UFBKVOMJGFSLHO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|