C14H7Cl2N2O5- — CID 7386526
2-[(3,4-dichlorophenyl)carbamoyl]-4-nitrobenzoate (PubChem CID 7386526) has the molecular formula C14H7Cl2N2O5- and a molecular weight of 354.13 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyl]-4-nitrobenzoate.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyl]-4-nitrobenzoate |
|---|---|
| PubChem CID | 7386526 |
| Molecular Formula | C14H7Cl2N2O5- |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyl]-4-nitrobenzoate |
| SMILES | O=C([O-])c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N2O5/c15-11-4-1-7(5-12(11)16)17-13(19)10-6-8(18(22)23)2-3-9(10)14(20)21/h1-6H,(H,17,19)(H,20,21)/p-1 |
| InChIKey | WJIGJWURNOBATK-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|