C16H15ClN4O4 — CID 55611030
2-chloro-4-[[2-(dimethylamino)-5-nitrobenzoyl]amino]benzamide (PubChem CID 55611030) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is 2-chloro-4-[[2-(dimethylamino)-5-nitrobenzoyl]amino]benzamide.
| Compound Name | 2-chloro-4-[[2-(dimethylamino)-5-nitrobenzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55611030 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-chloro-4-[[2-(dimethylamino)-5-nitrobenzoyl]amino]benzamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClN4O4/c1-20(2)14-6-4-10(21(24)25)8-12(14)16(23)19-9-3-5-11(15(18)22)13(17)7-9/h3-8H,1-2H3,(H2,18,22)(H,19,23) |
| InChIKey | NFSHJOKOZFZWPR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|