C21H19N5O4 — CID 39677239
N-[3-[[2-(dimethylamino)-5-nitrobenzoyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 39677239) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[3-[[2-(dimethylamino)-5-nitrobenzoyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[2-(dimethylamino)-5-nitrobenzoyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39677239 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[3-[[2-(dimethylamino)-5-nitrobenzoyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)Nc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C21H19N5O4/c1-25(2)19-7-6-17(26(29)30)13-18(19)21(28)24-16-5-3-4-15(12-16)23-20(27)14-8-10-22-11-9-14/h3-13H,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | IGMXVUYTCIWOIH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|