C19H24N4O5S — CID 36672196
N-[3-(butylsulfamoyl)phenyl]-2-(dimethylamino)-5-nitrobenzamide (PubChem CID 36672196) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-2-(dimethylamino)-5-nitrobenzamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-2-(dimethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 36672196 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-2-(dimethylamino)-5-nitrobenzamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)c1 |
| InChI | InChI=1S/C19H24N4O5S/c1-4-5-11-20-29(27,28)16-8-6-7-14(12-16)21-19(24)17-13-15(23(25)26)9-10-18(17)22(2)3/h6-10,12-13,20H,4-5,11H2,1-3H3,(H,21,24) |
| InChIKey | MLIGIXKNHZKFFH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|