C19H25N3O5S2 — CID 24672448
N-[3-(butylsulfamoyl)phenyl]-3-(ethylsulfonylamino)benzamide (PubChem CID 24672448) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-3-(ethylsulfonylamino)benzamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-3-(ethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 24672448 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-3-(ethylsulfonylamino)benzamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2cccc(NS(=O)(=O)CC)c2)c1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-3-5-12-20-29(26,27)18-11-7-9-16(14-18)21-19(23)15-8-6-10-17(13-15)22-28(24,25)4-2/h6-11,13-14,20,22H,3-5,12H2,1-2H3,(H,21,23) |
| InChIKey | XQSBLGUWMPKGHT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|