C21H27N3O7S — CID 24512899
4-(2-amino-2-oxoethoxy)-N-[3-(butylsulfamoyl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 24512899) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[3-(butylsulfamoyl)phenyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[3-(butylsulfamoyl)phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 24512899 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[3-(butylsulfamoyl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2cc(OC)c(OCC(N)=O)c(OC)c2)c1 |
| InChI | InChI=1S/C21H27N3O7S/c1-4-5-9-23-32(27,28)16-8-6-7-15(12-16)24-21(26)14-10-17(29-2)20(18(11-14)30-3)31-13-19(22)25/h6-8,10-12,23H,4-5,9,13H2,1-3H3,(H2,22,25)(H,24,26) |
| InChIKey | GRBGQTKDIKNWMT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|