C24H24N2O7 — CID 27901919
4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-[4-(2-methoxyphenoxy)phenyl]benzamide (PubChem CID 27901919) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-[4-(2-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-[4-(2-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 27901919 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3,5-dimethoxy-N-[4-(2-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)c2cc(OC)c(OCC(N)=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H24N2O7/c1-29-18-6-4-5-7-19(18)33-17-10-8-16(9-11-17)26-24(28)15-12-20(30-2)23(21(13-15)31-3)32-14-22(25)27/h4-13H,14H2,1-3H3,(H2,25,27)(H,26,28) |
| InChIKey | DVMMYPRUQTWEMJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |