C21H23ClN2O6 — CID 24590767
butyl 4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoyl]amino]benzoate (PubChem CID 24590767) has the molecular formula C21H23ClN2O6 and a molecular weight of 434.88 g/mol. Its IUPAC name is butyl 4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 24590767 |
| Molecular Formula | C21H23ClN2O6 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | butyl 4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxybenzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(Cl)c(OCC(N)=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23ClN2O6/c1-3-4-9-29-21(27)13-5-7-15(8-6-13)24-20(26)14-10-16(22)19(17(11-14)28-2)30-12-18(23)25/h5-8,10-11H,3-4,9,12H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | AVAMBXMIJOBEER-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|