C19H20ClN3O6 — CID 55840241
4-(2-amino-2-oxoethoxy)-N-[4-(3-amino-3-oxopropoxy)phenyl]-3-chloro-5-methoxybenzamide (PubChem CID 55840241) has the molecular formula C19H20ClN3O6 and a molecular weight of 421.84 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[4-(3-amino-3-oxopropoxy)phenyl]-3-chloro-5-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[4-(3-amino-3-oxopropoxy)phenyl]-3-chloro-5-methoxybenzamide |
|---|---|
| PubChem CID | 55840241 |
| Molecular Formula | C19H20ClN3O6 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[4-(3-amino-3-oxopropoxy)phenyl]-3-chloro-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OCCC(N)=O)cc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C19H20ClN3O6/c1-27-15-9-11(8-14(20)18(15)29-10-17(22)25)19(26)23-12-2-4-13(5-3-12)28-7-6-16(21)24/h2-5,8-9H,6-7,10H2,1H3,(H2,21,24)(H2,22,25)(H,23,26) |
| InChIKey | ITZMXCZHGAWNAN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |