C17H18ClN3O4 — CID 33150673
N-[4-(carbamoylamino)phenyl]-3-chloro-4-ethoxy-5-methoxybenzamide (PubChem CID 33150673) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-3-chloro-4-ethoxy-5-methoxybenzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-3-chloro-4-ethoxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 33150673 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-3-chloro-4-ethoxy-5-methoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc(NC(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C17H18ClN3O4/c1-3-25-15-13(18)8-10(9-14(15)24-2)16(22)20-11-4-6-12(7-5-11)21-17(19)23/h4-9H,3H2,1-2H3,(H,20,22)(H3,19,21,23) |
| InChIKey | ROOYREZCGNLHES-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |