C20H18ClNO3 — CID 3306078
3-chloro-4-ethoxy-5-methoxy-N-naphthalen-2-ylbenzamide (PubChem CID 3306078) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-naphthalen-2-ylbenzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 3306078 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-naphthalen-2-ylbenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C20H18ClNO3/c1-3-25-19-17(21)11-15(12-18(19)24-2)20(23)22-16-9-8-13-6-4-5-7-14(13)10-16/h4-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | UJSYXHAHIZAZGO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |