C17H16ClF2NO3S — CID 26908340
3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-5-methoxybenzamide (PubChem CID 26908340) has the molecular formula C17H16ClF2NO3S and a molecular weight of 387.84 g/mol. Its IUPAC name is 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-5-methoxybenzamide.
| Compound Name | 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 26908340 |
| Molecular Formula | C17H16ClF2NO3S |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-5-methoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc(SC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C17H16ClF2NO3S/c1-3-24-15-13(18)8-10(9-14(15)23-2)16(22)21-11-4-6-12(7-5-11)25-17(19)20/h4-9,17H,3H2,1-2H3,(H,21,22) |
| InChIKey | RMWTXCVJDDPZNR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |