C17H17F2NO4S — CID 4024378
N-[4-(difluoromethylsulfanyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 4024378) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4024378 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(SC(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17F2NO4S/c1-22-13-8-10(9-14(23-2)15(13)24-3)16(21)20-11-4-6-12(7-5-11)25-17(18)19/h4-9,17H,1-3H3,(H,20,21) |
| InChIKey | PRFQJUGXVLXNEQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |