C16H14F2N2O5S — CID 8701232
N-[4-(difluoromethylsulfanyl)phenyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 8701232) has the molecular formula C16H14F2N2O5S and a molecular weight of 384.36 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 8701232 |
| Molecular Formula | C16H14F2N2O5S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(SC(F)F)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14F2N2O5S/c1-24-13-7-11(12(20(22)23)8-14(13)25-2)15(21)19-9-3-5-10(6-4-9)26-16(17)18/h3-8,16H,1-2H3,(H,19,21) |
| InChIKey | LJKBDJGKGVIPHY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|