C19H19F2N3O5 — CID 42393819
4-(difluoromethoxy)-5-methoxy-2-nitro-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 42393819) has the molecular formula C19H19F2N3O5 and a molecular weight of 407.37 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-2-nitro-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 42393819 |
| Molecular Formula | C19H19F2N3O5 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCCC3)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H19F2N3O5/c1-28-16-10-14(15(24(26)27)11-17(16)29-19(20)21)18(25)22-12-4-6-13(7-5-12)23-8-2-3-9-23/h4-7,10-11,19H,2-3,8-9H2,1H3,(H,22,25) |
| InChIKey | OSKXCHJPWSGJHQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|