C15H13BrN2O5 — CID 1350567
N-(4-bromophenyl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 1350567) has the molecular formula C15H13BrN2O5 and a molecular weight of 381.18 g/mol. Its IUPAC name is N-(4-bromophenyl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(4-bromophenyl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 1350567 |
| Molecular Formula | C15H13BrN2O5 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | N-(4-bromophenyl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Br)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H13BrN2O5/c1-22-13-7-11(12(18(20)21)8-14(13)23-2)15(19)17-10-5-3-9(16)4-6-10/h3-8H,1-2H3,(H,17,19) |
| InChIKey | JJWMCYWEPDAQHJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|