C18H19N3O7 — CID 55566481
N-[4-(2-amino-2-oxoethoxy)phenyl]-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 55566481) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55566481 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(OCC(N)=O)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H19N3O7/c1-3-27-16-8-13(14(21(24)25)9-15(16)26-2)18(23)20-11-4-6-12(7-5-11)28-10-17(19)22/h4-9H,3,10H2,1-2H3,(H2,19,22)(H,20,23) |
| InChIKey | LMBRVLQRCQXZMD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|