C20H22N2O8 — CID 55916364
methyl 2-[4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-3-methylphenoxy]acetate (PubChem CID 55916364) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is methyl 2-[4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55916364 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | methyl 2-[4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-3-methylphenoxy]acetate |
| SMILES | CCOc1cc(C(=O)Nc2ccc(OCC(=O)OC)cc2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H22N2O8/c1-5-29-18-9-14(16(22(25)26)10-17(18)27-3)20(24)21-15-7-6-13(8-12(15)2)30-11-19(23)28-4/h6-10H,5,11H2,1-4H3,(H,21,24) |
| InChIKey | IYMLXVBJGDJWBW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|