C18H20N2O7 — CID 8927273
N-(2,4-dimethoxyphenyl)-4-ethoxy-5-methoxy-2-nitrobenzamide (PubChem CID 8927273) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-ethoxy-5-methoxy-2-nitrobenzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-ethoxy-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 8927273 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-ethoxy-5-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)Nc2ccc(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C18H20N2O7/c1-5-27-17-10-14(20(22)23)12(9-16(17)26-4)18(21)19-13-7-6-11(24-2)8-15(13)25-3/h6-10H,5H2,1-4H3,(H,19,21) |
| InChIKey | HPMSVEXHCCJEIN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|