C16H14ClFN2O5 — CID 18200168
N-(4-chloro-2-fluorophenyl)-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 18200168) has the molecular formula C16H14ClFN2O5 and a molecular weight of 368.75 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 18200168 |
| Molecular Formula | C16H14ClFN2O5 |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(Cl)cc2F)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14ClFN2O5/c1-3-25-15-7-10(13(20(22)23)8-14(15)24-2)16(21)19-12-5-4-9(17)6-11(12)18/h4-8H,3H2,1-2H3,(H,19,21) |
| InChIKey | WCFLJHUKXLXUGT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|