C18H18Cl2N2O5 — CID 46654233
N-[1-(2,4-dichlorophenyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 46654233) has the molecular formula C18H18Cl2N2O5 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 46654233 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)NC(C)c2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-4-27-17-8-13(15(22(24)25)9-16(17)26-3)18(23)21-10(2)12-6-5-11(19)7-14(12)20/h5-10H,4H2,1-3H3,(H,21,23) |
| InChIKey | CBRQMGRBKBJEAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|