C22H28N2O6 — CID 46585062
5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[1-(4-propan-2-ylphenyl)ethyl]benzamide (PubChem CID 46585062) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[1-(4-propan-2-ylphenyl)ethyl]benzamide.
| Compound Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[1-(4-propan-2-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46585062 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-[1-(4-propan-2-ylphenyl)ethyl]benzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NC(C)c2ccc(C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O6/c1-14(2)16-6-8-17(9-7-16)15(3)23-22(25)18-12-20(29-5)21(30-11-10-28-4)13-19(18)24(26)27/h6-9,12-15H,10-11H2,1-5H3,(H,23,25) |
| InChIKey | KDQWFCJIUPAEOD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|