C23H25FN4O6 — CID 55592791
N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55592791) has the molecular formula C23H25FN4O6 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55592791 |
| Molecular Formula | C23H25FN4O6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)NC(C)c2cnn(-c3ccc(F)cc3)c2C)cc1OC |
| InChI | InChI=1S/C23H25FN4O6/c1-14(19-13-25-27(15(19)2)17-7-5-16(24)6-8-17)26-23(29)18-11-21(33-4)22(34-10-9-32-3)12-20(18)28(30)31/h5-8,11-14H,9-10H2,1-4H3,(H,26,29) |
| InChIKey | WPOMCIWKICOFHD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|