C15H11Cl3N2O3 — CID 9441513
4-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-nitrobenzamide (PubChem CID 9441513) has the molecular formula C15H11Cl3N2O3 and a molecular weight of 373.62 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 9441513 |
| Molecular Formula | C15H11Cl3N2O3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 4-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-nitrobenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(Cl)cc1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl3N2O3/c1-8(11-4-2-9(16)6-13(11)18)19-15(21)12-5-3-10(17)7-14(12)20(22)23/h2-8H,1H3,(H,19,21)/t8-/m0/s1 |
| InChIKey | QAGOEDQLOKCRLS-QMMMGPOBSA-N |
| XLogP | 5.05 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|