C17H14Cl2N2O5 — CID 8503256
methyl 3-[[(1S)-1-(2,4-dichlorophenyl)ethyl]carbamoyl]-5-nitrobenzoate (PubChem CID 8503256) has the molecular formula C17H14Cl2N2O5 and a molecular weight of 397.21 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-(2,4-dichlorophenyl)ethyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[(1S)-1-(2,4-dichlorophenyl)ethyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 8503256 |
| Molecular Formula | C17H14Cl2N2O5 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | methyl 3-[[(1S)-1-(2,4-dichlorophenyl)ethyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N[C@@H](C)c2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14Cl2N2O5/c1-9(14-4-3-12(18)8-15(14)19)20-16(22)10-5-11(17(23)26-2)7-13(6-10)21(24)25/h3-9H,1-2H3,(H,20,22)/t9-/m0/s1 |
| InChIKey | HGNSXVKTWTXAOW-VIFPVBQESA-N |
| XLogP | 4.18 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|