C18H19Cl2N3O4 — CID 24514903
N-[1-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)-3-nitrobenzamide (PubChem CID 24514903) has the molecular formula C18H19Cl2N3O4 and a molecular weight of 412.27 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)-3-nitrobenzamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 24514903 |
| Molecular Formula | C18H19Cl2N3O4 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)-3-nitrobenzamide |
| SMILES | COCCNc1ccc(C(=O)NC(C)c2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19Cl2N3O4/c1-11(14-5-4-13(19)10-15(14)20)22-18(24)12-3-6-16(21-7-8-27-2)17(9-12)23(25)26/h3-6,9-11,21H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | HZDAPDRCFBXFTB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|