C18H16Cl2N2O6 — CID 2562561
[2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 2562561) has the molecular formula C18H16Cl2N2O6 and a molecular weight of 427.24 g/mol. Its IUPAC name is [2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 2562561 |
| Molecular Formula | C18H16Cl2N2O6 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N[C@@H](C)c2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16Cl2N2O6/c1-10(13-5-4-12(19)8-14(13)20)21-17(23)9-28-18(24)11-3-6-16(27-2)15(7-11)22(25)26/h3-8,10H,9H2,1-2H3,(H,21,23)/t10-/m0/s1 |
| InChIKey | XIVJCVIFNMTSFH-JTQLQIEISA-N |
| XLogP | 3.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|