C18H16Cl2N2O5 — CID 7476731
[(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-nitrobenzoate (PubChem CID 7476731) has the molecular formula C18H16Cl2N2O5 and a molecular weight of 411.24 g/mol. Its IUPAC name is [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-nitrobenzoate.
| Compound Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7476731 |
| Molecular Formula | C18H16Cl2N2O5 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O5/c1-10(15-7-6-13(19)9-16(15)20)21-17(23)11(2)27-18(24)12-4-3-5-14(8-12)22(25)26/h3-11H,1-2H3,(H,21,23)/t10-,11-/m1/s1 |
| InChIKey | MMILPZJYKBESCJ-GHMZBOCLSA-N |
| XLogP | 4.32 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|