C18H15Cl3N2O5 — CID 41320066
[(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate (PubChem CID 41320066) has the molecular formula C18H15Cl3N2O5 and a molecular weight of 445.69 g/mol. Its IUPAC name is [(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate.
| Compound Name | [(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 41320066 |
| Molecular Formula | C18H15Cl3N2O5 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-chloro-4-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3N2O5/c1-9(13-5-3-11(19)7-15(13)20)22-17(24)10(2)28-18(25)14-6-4-12(23(26)27)8-16(14)21/h3-10H,1-2H3,(H,22,24)/t9-,10+/m1/s1 |
| InChIKey | MBSDNHLEUJTOKR-ZJUUUORDSA-N |
| XLogP | 4.98 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|