C16H14Cl2N2O6 — CID 9454967
[(2S)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 9454967) has the molecular formula C16H14Cl2N2O6 and a molecular weight of 401.20 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2S)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454967 |
| Molecular Formula | C16H14Cl2N2O6 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [(2S)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])o1)C(=O)N[C@@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O6/c1-8(11-4-3-10(17)7-12(11)18)19-15(21)9(2)25-16(22)13-5-6-14(26-13)20(23)24/h3-9H,1-2H3,(H,19,21)/t8-,9-/m0/s1 |
| InChIKey | ANNRWDVLKWTWGL-IUCAKERBSA-N |
| XLogP | 3.92 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|