C23H20N2O5 — CID 7769143
[(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 3-nitrobenzoate (PubChem CID 7769143) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 3-nitrobenzoate.
| Compound Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7769143 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 3-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O5/c1-16(30-23(27)19-13-8-14-20(15-19)25(28)29)22(26)24-21(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-16,21H,1H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | IEWAIGWXYNRJQQ-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|