C11H11N3O6 — CID 7866140
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 3-nitrobenzoate (PubChem CID 7866140) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 3-nitrobenzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7866140 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 3-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H11N3O6/c1-6(9(15)13-11(12)17)20-10(16)7-3-2-4-8(5-7)14(18)19/h2-6H,1H3,(H3,12,13,15,17)/t6-/m0/s1 |
| InChIKey | JLGHPHFYAZWBAU-LURJTMIESA-N |
| XLogP | 0.34 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|