C15H11Cl2F2NO — CID 7986626
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2,4-difluorobenzamide (PubChem CID 7986626) has the molecular formula C15H11Cl2F2NO and a molecular weight of 330.16 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 7986626 |
| Molecular Formula | C15H11Cl2F2NO |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2,4-difluorobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(F)cc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2F2NO/c1-8(11-4-2-9(16)6-13(11)17)20-15(21)12-5-3-10(18)7-14(12)19/h2-8H,1H3,(H,20,21)/t8-/m1/s1 |
| InChIKey | YMNNQBUMHMASMK-MRVPVSSYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |