C15H11ClF3NO — CID 46591256
2-chloro-N-[1-(2,5-difluorophenyl)ethyl]-4-fluorobenzamide (PubChem CID 46591256) has the molecular formula C15H11ClF3NO and a molecular weight of 313.71 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,5-difluorophenyl)ethyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[1-(2,5-difluorophenyl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46591256 |
| Molecular Formula | C15H11ClF3NO |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-chloro-N-[1-(2,5-difluorophenyl)ethyl]-4-fluorobenzamide |
| SMILES | CC(NC(=O)c1ccc(F)cc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H11ClF3NO/c1-8(12-6-9(17)3-5-14(12)19)20-15(21)11-4-2-10(18)7-13(11)16/h2-8H,1H3,(H,20,21) |
| InChIKey | ZSXCBYGVRWXJFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |