C15H11F4NO — CID 51150419
N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide (PubChem CID 51150419) has the molecular formula C15H11F4NO and a molecular weight of 297.25 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51150419 |
| Molecular Formula | C15H11F4NO |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide |
| SMILES | CC(NC(=O)c1ccc(F)cc1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11F4NO/c1-8(11-4-2-9(16)6-13(11)18)20-15(21)12-5-3-10(17)7-14(12)19/h2-8H,1H3,(H,20,21) |
| InChIKey | MPFJFIFCTXSDAC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |