About N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide
N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide (PubChem CID 51150419) has the molecular formula C15H11F4NO
and a molecular weight of 297.25 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide |
| PubChem CID | 51150419 |
| Molecular Formula | C15H11F4NO |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide |
| SMILES | CC(NC(=O)c1ccc(F)cc1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11F4NO/c1-8(11-4-2-9(16)6-13(11)18)20-15(21)12-5-3-10(17)7-14(12)19/h2-8H,1H3,(H,20,21) |
| InChIKey | MPFJFIFCTXSDAC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide?
The IUPAC name of N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide (CID 51150419) is N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide.
What is the SMILES notation for N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide?
The canonical SMILES for N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide is CC(NC(=O)c1ccc(F)cc1F)c1ccc(F)cc1F.
What is the InChIKey of N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide?
The InChIKey is MPFJFIFCTXSDAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F4NO/c1-8(11-4-2-9(16)6-13(11)18)20-15(21)12-5-3-10(17)7-14(12)19/h2-8H,1H3,(H,20,21).
What are the key properties of N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide?
N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide has a molecular weight of 297.25 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,4-difluorophenyl)ethyl]-2,4-difluorobenzamide is sourced from PubChem (CID 51150419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).