C15H12F3NO — CID 8782133
N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-fluorobenzamide (PubChem CID 8782133) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-fluorobenzamide.
| Compound Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 8782133 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-fluorobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F3NO/c1-9(11-7-6-10(16)8-14(11)18)19-15(20)12-4-2-3-5-13(12)17/h2-9H,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | JMDIYXPPYHRYJF-SECBINFHSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |