C17H17F2NO — CID 112763839
N-[1-(2,4-difluorophenyl)ethyl]-2,3-dimethylbenzamide (PubChem CID 112763839) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 112763839 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(C)c2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C17H17F2NO/c1-10-5-4-6-14(11(10)2)17(21)20-12(3)15-8-7-13(18)9-16(15)19/h4-9,12H,1-3H3,(H,20,21) |
| InChIKey | LIGSYGYFASNKDI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |