C18H19F2NO4 — CID 51150413
N-[1-(2,4-difluorophenyl)ethyl]-2,3,4-trimethoxybenzamide (PubChem CID 51150413) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 51150413 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2ccc(F)cc2F)c(OC)c1OC |
| InChI | InChI=1S/C18H19F2NO4/c1-10(12-6-5-11(19)9-14(12)20)21-18(22)13-7-8-15(23-2)17(25-4)16(13)24-3/h5-10H,1-4H3,(H,21,22) |
| InChIKey | KMHSLSKQWJVMAS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |