C17H18FNO4 — CID 112836868
N-[1-(5-fluoro-2-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide (PubChem CID 112836868) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[1-(5-fluoro-2-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 112836868 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[1-(5-fluoro-2-methoxyphenyl)ethyl]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2cc(F)ccc2OC)c(O)c1 |
| InChI | InChI=1S/C17H18FNO4/c1-10(14-8-11(18)4-7-16(14)23-3)19-17(21)13-6-5-12(22-2)9-15(13)20/h4-10,20H,1-3H3,(H,19,21) |
| InChIKey | XFHOGOFGKGZSGF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |