C17H18FNO3 — CID 880770
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-fluorobenzamide (PubChem CID 880770) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 880770 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-fluorobenzamide |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FNO3/c1-11(15-10-14(21-2)8-9-16(15)22-3)19-17(20)12-4-6-13(18)7-5-12/h4-11H,1-3H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | FPCRNXWAVNRSSN-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |