C18H19F2NO5S — CID 9194269
4-(difluoromethylsulfonyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide (PubChem CID 9194269) has the molecular formula C18H19F2NO5S and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 9194269 |
| Molecular Formula | C18H19F2NO5S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C18H19F2NO5S/c1-11(15-10-13(25-2)6-9-16(15)26-3)21-17(22)12-4-7-14(8-5-12)27(23,24)18(19)20/h4-11,18H,1-3H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | RPGIPBBOHMEXMY-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |