C19H19FN2O3 — CID 39983681
N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-5-fluoro-1H-indole-2-carboxamide (PubChem CID 39983681) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39983681 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-5-fluoro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)c2cc3cc(F)ccc3[nH]2)c1 |
| InChI | InChI=1S/C19H19FN2O3/c1-11(15-10-14(24-2)5-7-18(15)25-3)21-19(23)17-9-12-8-13(20)4-6-16(12)22-17/h4-11,22H,1-3H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | JMGNBTDIPZGHPT-LLVKDONJSA-N |
| XLogP | 3.82 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |