C18H16F2N2O — CID 46588010
N-[1-(2,5-difluorophenyl)ethyl]-5-methyl-1H-indole-2-carboxamide (PubChem CID 46588010) has the molecular formula C18H16F2N2O and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-5-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-5-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46588010 |
| Molecular Formula | C18H16F2N2O |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-5-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NC(C)c3cc(F)ccc3F)cc2c1 |
| InChI | InChI=1S/C18H16F2N2O/c1-10-3-6-16-12(7-10)8-17(22-16)18(23)21-11(2)14-9-13(19)4-5-15(14)20/h3-9,11,22H,1-2H3,(H,21,23) |
| InChIKey | QZSZOPMFOCXPDR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |