C15H17FN2O3 — CID 119194117
(2S,3S)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 119194117) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is (2S,3S)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119194117 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2S,3S)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)C(NC(=O)c1cc2cc(F)ccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C15H17FN2O3/c1-3-8(2)13(15(20)21)18-14(19)12-7-9-6-10(16)4-5-11(9)17-12/h4-8,13,17H,3H2,1-2H3,(H,18,19)(H,20,21)/t8-,13?/m0/s1 |
| InChIKey | YPOABZGFYHIQIF-OADYLZGLSA-N |
| XLogP | 2.54 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |