C18H14F4N2O — CID 46474467
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-methyl-1H-indole-2-carboxamide (PubChem CID 46474467) has the molecular formula C18H14F4N2O and a molecular weight of 350.32 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46474467 |
| Molecular Formula | C18H14F4N2O |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)NCc3ccc(F)cc3C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C18H14F4N2O/c1-10-2-5-15-12(6-10)7-16(24-15)17(25)23-9-11-3-4-13(19)8-14(11)18(20,21)22/h2-8,24H,9H2,1H3,(H,23,25) |
| InChIKey | CUUWVMXDYLTLOM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |