C17H12F4N2O2 — CID 21014440
5-fluoro-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 21014440) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 5-fluoro-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 21014440 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-fluoro-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C17H12F4N2O2/c18-12-3-6-14-11(7-12)8-15(23-14)16(24)22-9-10-1-4-13(5-2-10)25-17(19,20)21/h1-8,23H,9H2,(H,22,24) |
| InChIKey | QCEVNFXKBPNZLU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |