C12H8F3NO4 — CID 170887093
3-oxo-3-[5-(trifluoromethoxy)-1H-indol-2-yl]propanoic acid (PubChem CID 170887093) has the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. Its IUPAC name is 3-oxo-3-[5-(trifluoromethoxy)-1H-indol-2-yl]propanoic acid.
| Compound Name | 3-oxo-3-[5-(trifluoromethoxy)-1H-indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170887093 |
| Molecular Formula | C12H8F3NO4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-oxo-3-[5-(trifluoromethoxy)-1H-indol-2-yl]propanoic acid |
| SMILES | O=C(O)CC(=O)c1cc2cc(OC(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C12H8F3NO4/c13-12(14,15)20-7-1-2-8-6(3-7)4-9(16-8)10(17)5-11(18)19/h1-4,16H,5H2,(H,18,19) |
| InChIKey | GAAMPBGVUOIIFC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|