C11H8F3NO3 — CID 68638607
2-[5-(trifluoromethoxy)-1H-indol-2-yl]acetic acid (PubChem CID 68638607) has the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. Its IUPAC name is 2-[5-(trifluoromethoxy)-1H-indol-2-yl]acetic acid.
| Compound Name | 2-[5-(trifluoromethoxy)-1H-indol-2-yl]acetic acid |
|---|---|
| PubChem CID | 68638607 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[5-(trifluoromethoxy)-1H-indol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1cc2cc(OC(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C11H8F3NO3/c12-11(13,14)18-8-1-2-9-6(4-8)3-7(15-9)5-10(16)17/h1-4,15H,5H2,(H,16,17) |
| InChIKey | RFZLNJYZUZNDKP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |