C18H14F3NO3 — CID 130432952
methyl 2-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboxylate (PubChem CID 130432952) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is methyl 2-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 2-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 130432952 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | methyl 2-[[4-(trifluoromethoxy)phenyl]methyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C18H14F3NO3/c1-24-17(23)12-4-7-16-13(9-12)10-14(22-16)8-11-2-5-15(6-3-11)25-18(19,20)21/h2-7,9-10,22H,8H2,1H3 |
| InChIKey | VWEBAPJWOZUBRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |